C28H26N2O5 — CID 23627288
2-[2-[4-[4-methyl-2-(1,2-oxazol-5-yl)phenoxy]butoxy]carbazol-9-yl]acetic acid (PubChem CID 23627288) has the molecular formula C28H26N2O5 and a molecular weight of 470.53 g/mol. Its IUPAC name is 2-[2-[4-[4-methyl-2-(1,2-oxazol-5-yl)phenoxy]butoxy]carbazol-9-yl]acetic acid.
| Compound Name | 2-[2-[4-[4-methyl-2-(1,2-oxazol-5-yl)phenoxy]butoxy]carbazol-9-yl]acetic acid |
|---|---|
| PubChem CID | 23627288 |
| Molecular Formula | C28H26N2O5 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 2-[2-[4-[4-methyl-2-(1,2-oxazol-5-yl)phenoxy]butoxy]carbazol-9-yl]acetic acid |
| SMILES | Cc1ccc(OCCCCOc2ccc3c4ccccc4n(CC(=O)O)c3c2)c(-c2ccno2)c1 |
| InChI | InChI=1S/C28H26N2O5/c1-19-8-11-26(23(16-19)27-12-13-29-35-27)34-15-5-4-14-33-20-9-10-22-21-6-2-3-7-24(21)30(18-28(31)32)25(22)17-20/h2-3,6-13,16-17H,4-5,14-15,18H2,1H3,(H,31,32) |
| InChIKey | OAZJCRBXXCJLOF-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|