C19H23N7O3S2 — CID 143496350
3-[6-amino-8-[(7-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)sulfanyl]purin-9-yl]-1,1-diethoxypropan-1-ol (PubChem CID 143496350) has the molecular formula C19H23N7O3S2 and a molecular weight of 461.57 g/mol. Its IUPAC name is 3-[6-amino-8-[(7-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)sulfanyl]purin-9-yl]-1,1-diethoxypropan-1-ol.
| Compound Name | 3-[6-amino-8-[(7-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)sulfanyl]purin-9-yl]-1,1-diethoxypropan-1-ol |
|---|---|
| PubChem CID | 143496350 |
| Molecular Formula | C19H23N7O3S2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 3-[6-amino-8-[(7-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)sulfanyl]purin-9-yl]-1,1-diethoxypropan-1-ol |
| SMILES | CCOC(O)(CCn1c(Sc2nc3cncc(C)c3s2)nc2c(N)ncnc21)OCC |
| InChI | InChI=1S/C19H23N7O3S2/c1-4-28-19(27,29-5-2)6-7-26-16-13(15(20)22-10-23-16)25-17(26)31-18-24-12-9-21-8-11(3)14(12)30-18/h8-10,27H,4-7H2,1-3H3,(H2,20,22,23) |
| InChIKey | QXCCAZLPWPXUKL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 134.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|