C14H12ClN6O4PS2 — CID 69478062
2-[6-amino-8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]purin-9-yl]ethyl dihydrogen phosphate (PubChem CID 69478062) has the molecular formula C14H12ClN6O4PS2 and a molecular weight of 458.85 g/mol. Its IUPAC name is 2-[6-amino-8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]purin-9-yl]ethyl dihydrogen phosphate.
| Compound Name | 2-[6-amino-8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]purin-9-yl]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 69478062 |
| Molecular Formula | C14H12ClN6O4PS2 |
| Molecular Weight | 458.85 g/mol |
| Exact Mass | 457.98 |
| IUPAC Name | 2-[6-amino-8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]purin-9-yl]ethyl dihydrogen phosphate |
| SMILES | Nc1ncnc2c1nc(Sc1nc3cccc(Cl)c3s1)n2CCOP(=O)(O)O |
| InChI | InChI=1S/C14H12ClN6O4PS2/c15-7-2-1-3-8-10(7)27-14(19-8)28-13-20-9-11(16)17-6-18-12(9)21(13)4-5-25-26(22,23)24/h1-3,6H,4-5H2,(H2,16,17,18)(H2,22,23,24) |
| InChIKey | LAJWPPANTGASDL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 149.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.85 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|