C21H22N8O3S2 — CID 68521022
1-[4-[2-[6-amino-8-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]purin-9-yl]ethyl]piperidin-1-yl]ethanone (PubChem CID 68521022) has the molecular formula C21H22N8O3S2 and a molecular weight of 498.59 g/mol. Its IUPAC name is 1-[4-[2-[6-amino-8-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]purin-9-yl]ethyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[2-[6-amino-8-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]purin-9-yl]ethyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 68521022 |
| Molecular Formula | C21H22N8O3S2 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | 1-[4-[2-[6-amino-8-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]purin-9-yl]ethyl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(CCn2c(Sc3nc4ccc([N+](=O)[O-])cc4s3)nc3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C21H22N8O3S2/c1-12(30)27-7-4-13(5-8-27)6-9-28-19-17(18(22)23-11-24-19)26-20(28)34-21-25-15-3-2-14(29(31)32)10-16(15)33-21/h2-3,10-11,13H,4-9H2,1H3,(H2,22,23,24) |
| InChIKey | JOSQMZOHQBFQJQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 145.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|