C21H17F2N — CID 143497249
3,3-bis(4-fluorophenyl)-3-phenylprop-1-en-2-amine (PubChem CID 143497249) has the molecular formula C21H17F2N and a molecular weight of 321.37 g/mol. Its IUPAC name is 3,3-bis(4-fluorophenyl)-3-phenylprop-1-en-2-amine.
| Compound Name | 3,3-bis(4-fluorophenyl)-3-phenylprop-1-en-2-amine |
|---|---|
| PubChem CID | 143497249 |
| Molecular Formula | C21H17F2N |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 3,3-bis(4-fluorophenyl)-3-phenylprop-1-en-2-amine |
| SMILES | C=C(N)C(c1ccccc1)(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H17F2N/c1-15(24)21(16-5-3-2-4-6-16,17-7-11-19(22)12-8-17)18-9-13-20(23)14-10-18/h2-14H,1,24H2 |
| InChIKey | YMUCXGQAARILNI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|