C23H28O4 — CID 143500448
4-[3-(1-cyclohepta-1,3,4,6-tetraen-1-ylethenyl)-1,2,5-trioxaspiro[5.5]undecan-9-ylidene]hexan-3-one (PubChem CID 143500448) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is 4-[3-(1-cyclohepta-1,3,4,6-tetraen-1-ylethenyl)-1,2,5-trioxaspiro[5.5]undecan-9-ylidene]hexan-3-one.
| Compound Name | 4-[3-(1-cyclohepta-1,3,4,6-tetraen-1-ylethenyl)-1,2,5-trioxaspiro[5.5]undecan-9-ylidene]hexan-3-one |
|---|---|
| PubChem CID | 143500448 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 4-[3-(1-cyclohepta-1,3,4,6-tetraen-1-ylethenyl)-1,2,5-trioxaspiro[5.5]undecan-9-ylidene]hexan-3-one |
| SMILES | C=C(C1=CC=C=CC=C1)C1COC2(CCC(=C(CC)C(=O)CC)CC2)OO1 |
| InChI | InChI=1S/C23H28O4/c1-4-20(21(24)5-2)19-12-14-23(15-13-19)25-16-22(26-27-23)17(3)18-10-8-6-7-9-11-18/h6,8-11,22H,3-5,12-16H2,1-2H3/b20-19- |
| InChIKey | DZMPOXSCSLBUKN-VXPUYCOJSA-N |
| XLogP | 5.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|