C44H56N4O6 — CID 143501150
2-[3-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl-methylamino]propyl-[2-[(4E)-5-ethenyl-4-ethylidene-1,3-dioxoisoquinolin-2-yl]ethyl]amino]ethyl acetate;heptane (PubChem CID 143501150) has the molecular formula C44H56N4O6 and a molecular weight of 736.95 g/mol. Its IUPAC name is 2-[3-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl-methylamino]propyl-[2-[(4E)-5-ethenyl-4-ethylidene-1,3-dioxoisoquinolin-2-yl]ethyl]amino]ethyl acetate;heptane.
| Compound Name | 2-[3-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl-methylamino]propyl-[2-[(4E)-5-ethenyl-4-ethylidene-1,3-dioxoisoquinolin-2-yl]ethyl]amino]ethyl acetate;heptane |
|---|---|
| PubChem CID | 143501150 |
| Molecular Formula | C44H56N4O6 |
| Molecular Weight | 736.95 g/mol |
| Exact Mass | 736.42 |
| IUPAC Name | 2-[3-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl-methylamino]propyl-[2-[(4E)-5-ethenyl-4-ethylidene-1,3-dioxoisoquinolin-2-yl]ethyl]amino]ethyl acetate;heptane |
| SMILES | C=Cc1cccc2c1/C(=C\C)C(=O)N(CCN(CCCN(C)CCN1C(=O)c3cccc4cccc(c34)C1=O)CCOC(C)=O)C2=O.CCCCCCC |
| InChI | InChI=1S/C37H40N4O6.C7H16/c1-5-26-11-7-14-29-32(26)28(6-2)34(43)41(35(29)44)22-20-39(23-24-47-25(3)42)18-10-17-38(4)19-21-40-36(45)30-15-8-12-27-13-9-16-31(33(27)30)37(40)46;1-3-5-7-6-4-2/h5-9,11-16H,1,10,17-24H2,2-4H3;3-7H2,1-2H3/b28-6+; |
| InChIKey | BEFFRZDSNOBHFS-FUVKFKNKSA-N |
| XLogP | 7.33 |
| TPSA | 107.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.95 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|