C42H53N3O4 — CID 89299893
(4E)-2-[3-[9-[[5-(8-acetylnaphthalen-1-yl)-5-oxopentyl]amino]nonylamino]propyl]-5-ethenyl-4-ethylideneisoquinoline-1,3-dione (PubChem CID 89299893) has the molecular formula C42H53N3O4 and a molecular weight of 663.90 g/mol. Its IUPAC name is (4E)-2-[3-[9-[[5-(8-acetylnaphthalen-1-yl)-5-oxopentyl]amino]nonylamino]propyl]-5-ethenyl-4-ethylideneisoquinoline-1,3-dione.
| Compound Name | (4E)-2-[3-[9-[[5-(8-acetylnaphthalen-1-yl)-5-oxopentyl]amino]nonylamino]propyl]-5-ethenyl-4-ethylideneisoquinoline-1,3-dione |
|---|---|
| PubChem CID | 89299893 |
| Molecular Formula | C42H53N3O4 |
| Molecular Weight | 663.90 g/mol |
| Exact Mass | 663.40 |
| IUPAC Name | (4E)-2-[3-[9-[[5-(8-acetylnaphthalen-1-yl)-5-oxopentyl]amino]nonylamino]propyl]-5-ethenyl-4-ethylideneisoquinoline-1,3-dione |
| SMILES | C=Cc1cccc2c1/C(=C\C)C(=O)N(CCCNCCCCCCCCCNCCCCC(=O)c1cccc3cccc(C(C)=O)c13)C2=O |
| InChI | InChI=1S/C42H53N3O4/c1-4-32-19-15-24-37-39(32)34(5-2)41(48)45(42(37)49)30-18-29-44-27-13-10-8-6-7-9-12-26-43-28-14-11-25-38(47)36-23-17-21-33-20-16-22-35(31(3)46)40(33)36/h4-5,15-17,19-24,43-44H,1,6-14,18,25-30H2,2-3H3/b34-5+ |
| InChIKey | ZHQNSHCAFJTGOO-OSFRLPQNSA-N |
| XLogP | 8.42 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.90 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|