C23H19Cl3N4O — CID 143503604
5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole;N-(pyridin-3-ylmethyl)formamide (PubChem CID 143503604) has the molecular formula C23H19Cl3N4O and a molecular weight of 473.79 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole;N-(pyridin-3-ylmethyl)formamide.
| Compound Name | 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole;N-(pyridin-3-ylmethyl)formamide |
|---|---|
| PubChem CID | 143503604 |
| Molecular Formula | C23H19Cl3N4O |
| Molecular Weight | 473.79 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole;N-(pyridin-3-ylmethyl)formamide |
| SMILES | Cc1cnn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1.O=CNCc1cccnc1 |
| InChI | InChI=1S/C16H11Cl3N2.C7H8N2O/c1-10-9-20-21(15-7-6-13(18)8-14(15)19)16(10)11-2-4-12(17)5-3-11;10-6-9-5-7-2-1-3-8-4-7/h2-9H,1H3;1-4,6H,5H2,(H,9,10) |
| InChIKey | ATBBHKPGUYBETH-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.79 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|