C27H30N5O3S+ — CID 143511116
[4-[3-cyano-1-cyclobutyl-6-(2-imidazol-1-ylethoxy)indol-2-yl]phenyl]-propylsulfonylazanium (PubChem CID 143511116) has the molecular formula C27H30N5O3S+ and a molecular weight of 504.64 g/mol. Its IUPAC name is [4-[3-cyano-1-cyclobutyl-6-(2-imidazol-1-ylethoxy)indol-2-yl]phenyl]-propylsulfonylazanium.
| Compound Name | [4-[3-cyano-1-cyclobutyl-6-(2-imidazol-1-ylethoxy)indol-2-yl]phenyl]-propylsulfonylazanium |
|---|---|
| PubChem CID | 143511116 |
| Molecular Formula | C27H30N5O3S+ |
| Molecular Weight | 504.64 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | [4-[3-cyano-1-cyclobutyl-6-(2-imidazol-1-ylethoxy)indol-2-yl]phenyl]-propylsulfonylazanium |
| SMILES | CCCS(=O)(=O)[NH2+]c1ccc(-c2c(C#N)c3ccc(OCCn4ccnc4)cc3n2C2CCC2)cc1 |
| InChI | InChI=1S/C27H29N5O3S/c1-2-16-36(33,34)30-21-8-6-20(7-9-21)27-25(18-28)24-11-10-23(35-15-14-31-13-12-29-19-31)17-26(24)32(27)22-4-3-5-22/h6-13,17,19,22,30H,2-5,14-16H2,1H3/p+1 |
| InChIKey | KQEBPOMDXLYOGF-UHFFFAOYSA-O |
| XLogP | 4.12 |
| TPSA | 106.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.64 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|