C32H34N4O6 — CID 143528374
N-(4-methylphenyl)-2-[(4R)-4-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide (PubChem CID 143528374) has the molecular formula C32H34N4O6 and a molecular weight of 570.65 g/mol. Its IUPAC name is N-(4-methylphenyl)-2-[(4R)-4-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide.
| Compound Name | N-(4-methylphenyl)-2-[(4R)-4-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide |
|---|---|
| PubChem CID | 143528374 |
| Molecular Formula | C32H34N4O6 |
| Molecular Weight | 570.65 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | N-(4-methylphenyl)-2-[(4R)-4-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide |
| SMILES | Cc1ccc(NC(=O)C(C(C)c2ccccc2)N2C(=O)N[C@H](c3ccc(OCC(=O)N4CCOCC4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C32H34N4O6/c1-21-8-12-25(13-9-21)33-30(38)29(22(2)23-6-4-3-5-7-23)36-31(39)28(34-32(36)40)24-10-14-26(15-11-24)42-20-27(37)35-16-18-41-19-17-35/h3-15,22,28-29H,16-20H2,1-2H3,(H,33,38)(H,34,40)/t22?,28-,29?/m1/s1 |
| InChIKey | MXDDZTKWKHPVCC-UVQWTNAYSA-N |
| XLogP | 3.64 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.65 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|