C20H13ClO4 — CID 143532366
4'-chlorospiro[1H-2-benzofuran-3,9'-xanthene]-3',6'-diol (PubChem CID 143532366) has the molecular formula C20H13ClO4 and a molecular weight of 352.77 g/mol. Its IUPAC name is 4'-chlorospiro[1H-2-benzofuran-3,9'-xanthene]-3',6'-diol.
| Compound Name | 4'-chlorospiro[1H-2-benzofuran-3,9'-xanthene]-3',6'-diol |
|---|---|
| PubChem CID | 143532366 |
| Molecular Formula | C20H13ClO4 |
| Molecular Weight | 352.77 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 4'-chlorospiro[1H-2-benzofuran-3,9'-xanthene]-3',6'-diol |
| SMILES | Oc1ccc2c(c1)Oc1c(ccc(O)c1Cl)C21OCc2ccccc21 |
| InChI | InChI=1S/C20H13ClO4/c21-18-16(23)8-7-15-19(18)25-17-9-12(22)5-6-14(17)20(15)13-4-2-1-3-11(13)10-24-20/h1-9,22-23H,10H2 |
| InChIKey | AIPDTPAOWQFOQN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.77 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |