C20H16O4 — CID 159219577
spiro[1H-2-benzofuran-3,9'-3,9a-dihydroxanthene]-3',6'-diol (PubChem CID 159219577) has the molecular formula C20H16O4 and a molecular weight of 320.34 g/mol. Its IUPAC name is spiro[1H-2-benzofuran-3,9'-3,9a-dihydroxanthene]-3',6'-diol.
| Compound Name | spiro[1H-2-benzofuran-3,9'-3,9a-dihydroxanthene]-3',6'-diol |
|---|---|
| PubChem CID | 159219577 |
| Molecular Formula | C20H16O4 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | spiro[1H-2-benzofuran-3,9'-3,9a-dihydroxanthene]-3',6'-diol |
| SMILES | Oc1ccc2c(c1)OC1=CC(O)C=CC1C21OCc2ccccc21 |
| InChI | InChI=1S/C20H16O4/c21-13-5-7-16-18(9-13)24-19-10-14(22)6-8-17(19)20(16)15-4-2-1-3-12(15)11-23-20/h1-10,13,16,21-22H,11H2 |
| InChIKey | PIDDGVQYKQNPST-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|