C25H25F2N5O2 — CID 143535405
fluorobenzene;(8R)-2-[(Z)-1-fluoro-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-ol (PubChem CID 143535405) has the molecular formula C25H25F2N5O2 and a molecular weight of 465.50 g/mol. Its IUPAC name is fluorobenzene;(8R)-2-[(Z)-1-fluoro-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-ol.
| Compound Name | fluorobenzene;(8R)-2-[(Z)-1-fluoro-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-ol |
|---|---|
| PubChem CID | 143535405 |
| Molecular Formula | C25H25F2N5O2 |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | fluorobenzene;(8R)-2-[(Z)-1-fluoro-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-ol |
| SMILES | COc1cc(/C=C(\F)c2nc3n(n2)CCC[C@H]3O)ccc1-n1cnc(C)c1.Fc1ccccc1 |
| InChI | InChI=1S/C19H20FN5O2.C6H5F/c1-12-10-24(11-21-12)15-6-5-13(9-17(15)27-2)8-14(20)18-22-19-16(26)4-3-7-25(19)23-18;7-6-4-2-1-3-5-6/h5-6,8-11,16,26H,3-4,7H2,1-2H3;1-5H/b14-8-;/t16-;/m1./s1 |
| InChIKey | URWIRAFRVSVYAG-BOVIILNCSA-N |
| XLogP | 4.90 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |