C28H41NO — CID 143539682
1-(2,2-dimethylbutylamino)-5-(10-ethenyl-8-methyl-4-tricyclo[7.4.1.05,14]tetradeca-3,5,7,9,11,12-hexaenyl)pentan-1-ol;molecular hydrogen (PubChem CID 143539682) has the molecular formula C28H41NO and a molecular weight of 407.64 g/mol. Its IUPAC name is 1-(2,2-dimethylbutylamino)-5-(10-ethenyl-8-methyl-4-tricyclo[7.4.1.05,14]tetradeca-3,5,7,9,11,12-hexaenyl)pentan-1-ol;molecular hydrogen.
| Compound Name | 1-(2,2-dimethylbutylamino)-5-(10-ethenyl-8-methyl-4-tricyclo[7.4.1.05,14]tetradeca-3,5,7,9,11,12-hexaenyl)pentan-1-ol;molecular hydrogen |
|---|---|
| PubChem CID | 143539682 |
| Molecular Formula | C28H41NO |
| Molecular Weight | 407.64 g/mol |
| Exact Mass | 407.32 |
| IUPAC Name | 1-(2,2-dimethylbutylamino)-5-(10-ethenyl-8-methyl-4-tricyclo[7.4.1.05,14]tetradeca-3,5,7,9,11,12-hexaenyl)pentan-1-ol;molecular hydrogen |
| SMILES | C=CC1=C2C(C)=CC=C3C(CCCCC(O)NCC(C)(C)CC)=CCC(C=C=C1)C32.[H][H] |
| InChI | InChI=1S/C28H39NO.H2/c1-6-21-12-10-13-23-17-16-22(24-18-15-20(3)26(21)27(23)24)11-8-9-14-25(30)29-19-28(4,5)7-2;/h6,12-13,15-16,18,23,25,27,29-30H,1,7-9,11,14,17,19H2,2-5H3;1H |
| InChIKey | UEDGGXSOKWFQRQ-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.64 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|