C31H36N4O4S — CID 143542512
(E)-3-[5-[(4-tert-butylphenyl)sulfonylamino]-3-phenyl-1H-indol-2-yl]-N-[2-(2-hydroxyethylamino)ethyl]prop-2-enamide (PubChem CID 143542512) has the molecular formula C31H36N4O4S and a molecular weight of 560.72 g/mol. Its IUPAC name is (E)-3-[5-[(4-tert-butylphenyl)sulfonylamino]-3-phenyl-1H-indol-2-yl]-N-[2-(2-hydroxyethylamino)ethyl]prop-2-enamide.
| Compound Name | (E)-3-[5-[(4-tert-butylphenyl)sulfonylamino]-3-phenyl-1H-indol-2-yl]-N-[2-(2-hydroxyethylamino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 143542512 |
| Molecular Formula | C31H36N4O4S |
| Molecular Weight | 560.72 g/mol |
| Exact Mass | 560.25 |
| IUPAC Name | (E)-3-[5-[(4-tert-butylphenyl)sulfonylamino]-3-phenyl-1H-indol-2-yl]-N-[2-(2-hydroxyethylamino)ethyl]prop-2-enamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc3[nH]c(/C=C/C(=O)NCCNCCO)c(-c4ccccc4)c3c2)cc1 |
| InChI | InChI=1S/C31H36N4O4S/c1-31(2,3)23-9-12-25(13-10-23)40(38,39)35-24-11-14-27-26(21-24)30(22-7-5-4-6-8-22)28(34-27)15-16-29(37)33-18-17-32-19-20-36/h4-16,21,32,34-36H,17-20H2,1-3H3,(H,33,37)/b16-15+ |
| InChIKey | PROMDROBLAVICR-FOCLMDBBSA-N |
| XLogP | 4.64 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.72 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|