C18H30O2 — CID 143562353
[4-(7-but-1-en-2-yloxyheptyl)cyclohexa-1,3-dien-1-yl]methanol (PubChem CID 143562353) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is [4-(7-but-1-en-2-yloxyheptyl)cyclohexa-1,3-dien-1-yl]methanol.
| Compound Name | [4-(7-but-1-en-2-yloxyheptyl)cyclohexa-1,3-dien-1-yl]methanol |
|---|---|
| PubChem CID | 143562353 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | [4-(7-but-1-en-2-yloxyheptyl)cyclohexa-1,3-dien-1-yl]methanol |
| SMILES | C=C(CC)OCCCCCCCC1=CC=C(CO)CC1 |
| InChI | InChI=1S/C18H30O2/c1-3-16(2)20-14-8-6-4-5-7-9-17-10-12-18(15-19)13-11-17/h10,12,19H,2-9,11,13-15H2,1H3 |
| InChIKey | AYRXAJNSPXJRJY-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|