C15H14 — CID 143564925
1-(1-phenylpropyl)cyclohexa-1,3-dien-5-yne (PubChem CID 143564925) has the molecular formula C15H14 and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-(1-phenylpropyl)cyclohexa-1,3-dien-5-yne.
| Compound Name | 1-(1-phenylpropyl)cyclohexa-1,3-dien-5-yne |
|---|---|
| PubChem CID | 143564925 |
| Molecular Formula | C15H14 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 1-(1-phenylpropyl)cyclohexa-1,3-dien-5-yne |
| SMILES | CCC(c1c#cccc1)c1ccccc1 |
| InChI | InChI=1S/C15H14/c1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-7,9-11,15H,2H2,1H3 |
| InChIKey | UFCPTBZNFUJNMF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |