C20H25Cl2N3O2S — CID 143565905
1-[[(2R,8aS)-1,2,3,4,4a,8a-hexahydronaphthalen-2-yl]sulfonyl]-4-(3,5-dichloro-4-pyridinyl)-1,4-diazepane (PubChem CID 143565905) has the molecular formula C20H25Cl2N3O2S and a molecular weight of 442.41 g/mol. Its IUPAC name is 1-[[(2R,8aS)-1,2,3,4,4a,8a-hexahydronaphthalen-2-yl]sulfonyl]-4-(3,5-dichloro-4-pyridinyl)-1,4-diazepane.
| Compound Name | 1-[[(2R,8aS)-1,2,3,4,4a,8a-hexahydronaphthalen-2-yl]sulfonyl]-4-(3,5-dichloro-4-pyridinyl)-1,4-diazepane |
|---|---|
| PubChem CID | 143565905 |
| Molecular Formula | C20H25Cl2N3O2S |
| Molecular Weight | 442.41 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 1-[[(2R,8aS)-1,2,3,4,4a,8a-hexahydronaphthalen-2-yl]sulfonyl]-4-(3,5-dichloro-4-pyridinyl)-1,4-diazepane |
| SMILES | O=S(=O)([C@@H]1CCC2C=CC=C[C@@H]2C1)N1CCCN(c2c(Cl)cncc2Cl)CC1 |
| InChI | InChI=1S/C20H25Cl2N3O2S/c21-18-13-23-14-19(22)20(18)24-8-3-9-25(11-10-24)28(26,27)17-7-6-15-4-1-2-5-16(15)12-17/h1-2,4-5,13-17H,3,6-12H2/t15?,16-,17-/m1/s1 |
| InChIKey | LQGOZNIBYDDWEM-YJEKIOLLSA-N |
| XLogP | 4.14 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |