C18H33NO2 — CID 143567049
2-(hydroxymethyl)-1-[6-(4-methylcyclopenten-1-yl)hexyl]piperidin-4-ol (PubChem CID 143567049) has the molecular formula C18H33NO2 and a molecular weight of 295.47 g/mol. Its IUPAC name is 2-(hydroxymethyl)-1-[6-(4-methylcyclopenten-1-yl)hexyl]piperidin-4-ol.
| Compound Name | 2-(hydroxymethyl)-1-[6-(4-methylcyclopenten-1-yl)hexyl]piperidin-4-ol |
|---|---|
| PubChem CID | 143567049 |
| Molecular Formula | C18H33NO2 |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.25 |
| IUPAC Name | 2-(hydroxymethyl)-1-[6-(4-methylcyclopenten-1-yl)hexyl]piperidin-4-ol |
| SMILES | CC1CC=C(CCCCCCN2CCC(O)CC2CO)C1 |
| InChI | InChI=1S/C18H33NO2/c1-15-7-8-16(12-15)6-4-2-3-5-10-19-11-9-18(21)13-17(19)14-20/h8,15,17-18,20-21H,2-7,9-14H2,1H3 |
| InChIKey | RWNVVWYLKOCIHC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|