C18H31NO — CID 137338862
(2R,4S)-2-cyclopropyl-1-[(2E)-3,7-dimethylocta-2,6-dienyl]piperidin-4-ol (PubChem CID 137338862) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is (2R,4S)-2-cyclopropyl-1-[(2E)-3,7-dimethylocta-2,6-dienyl]piperidin-4-ol.
| Compound Name | (2R,4S)-2-cyclopropyl-1-[(2E)-3,7-dimethylocta-2,6-dienyl]piperidin-4-ol |
|---|---|
| PubChem CID | 137338862 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | (2R,4S)-2-cyclopropyl-1-[(2E)-3,7-dimethylocta-2,6-dienyl]piperidin-4-ol |
| SMILES | CC(C)=CCC/C(C)=C/CN1CC[C@H](O)C[C@@H]1C1CC1 |
| InChI | InChI=1S/C18H31NO/c1-14(2)5-4-6-15(3)9-11-19-12-10-17(20)13-18(19)16-7-8-16/h5,9,16-18,20H,4,6-8,10-13H2,1-3H3/b15-9+/t17-,18+/m0/s1 |
| InChIKey | VGPPLXCLZCPCGU-MWHPXJCRSA-N |
| XLogP | 3.91 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|