C24H34N4O — CID 143568923
2-ethoxy-4-N,4-N-diethyl-1-N-methyl-1-N-[(E)-[(Z)-4-[2-(methylamino)phenyl]but-3-enylidene]amino]benzene-1,4-diamine (PubChem CID 143568923) has the molecular formula C24H34N4O and a molecular weight of 394.56 g/mol. Its IUPAC name is 2-ethoxy-4-N,4-N-diethyl-1-N-methyl-1-N-[(E)-[(Z)-4-[2-(methylamino)phenyl]but-3-enylidene]amino]benzene-1,4-diamine.
| Compound Name | 2-ethoxy-4-N,4-N-diethyl-1-N-methyl-1-N-[(E)-[(Z)-4-[2-(methylamino)phenyl]but-3-enylidene]amino]benzene-1,4-diamine |
|---|---|
| PubChem CID | 143568923 |
| Molecular Formula | C24H34N4O |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 2-ethoxy-4-N,4-N-diethyl-1-N-methyl-1-N-[(E)-[(Z)-4-[2-(methylamino)phenyl]but-3-enylidene]amino]benzene-1,4-diamine |
| SMILES | CCOc1cc(N(CC)CC)ccc1N(C)/N=C/C/C=C\c1ccccc1NC |
| InChI | InChI=1S/C24H34N4O/c1-6-28(7-2)21-16-17-23(24(19-21)29-8-3)27(5)26-18-12-11-14-20-13-9-10-15-22(20)25-4/h9-11,13-19,25H,6-8,12H2,1-5H3/b14-11-,26-18+ |
| InChIKey | AHESFGTZHNGFTM-OLHPPVPKSA-N |
| XLogP | 5.50 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|