About 1-(1,3-benzodioxol-5-yl)-3-(3-fluoro-4-imidazol-1-ylphenyl)urea;molecular hydrogen
1-(1,3-benzodioxol-5-yl)-3-(3-fluoro-4-imidazol-1-ylphenyl)urea;molecular hydrogen (PubChem CID 143582920) has the molecular formula C17H17FN4O3
and a molecular weight of 344.35 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-(3-fluoro-4-imidazol-1-ylphenyl)urea;molecular hydrogen.
Molecular Properties
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-(3-fluoro-4-imidazol-1-ylphenyl)urea;molecular hydrogen |
| PubChem CID | 143582920 |
| Molecular Formula | C17H17FN4O3 |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-(3-fluoro-4-imidazol-1-ylphenyl)urea;molecular hydrogen |
| SMILES | O=C(Nc1ccc(-n2ccnc2)c(F)c1)Nc1ccc2c(c1)OCO2.[H][H].[H][H] |
| InChI | InChI=1S/C17H13FN4O3.2H2/c18-13-7-11(1-3-14(13)22-6-5-19-9-22)20-17(23)21-12-2-4-15-16(8-12)25-10-24-15;;/h1-9H,10H2,(H2,20,21,23);2*1H |
| InChIKey | CHEKQLRJBGHPQB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(1,3-benzodioxol-5-yl)-3-(3-fluoro-4-imidazol-1-ylphenyl)urea;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-benzodioxol-5-yl)-3-(3-fluoro-4-imidazol-1-ylphenyl)urea;molecular hydrogen?
The IUPAC name of 1-(1,3-benzodioxol-5-yl)-3-(3-fluoro-4-imidazol-1-ylphenyl)urea;molecular hydrogen (CID 143582920) is 1-(1,3-benzodioxol-5-yl)-3-(3-fluoro-4-imidazol-1-ylphenyl)urea;molecular hydrogen.
What is the SMILES notation for 1-(1,3-benzodioxol-5-yl)-3-(3-fluoro-4-imidazol-1-ylphenyl)urea;molecular hydrogen?
The canonical SMILES for 1-(1,3-benzodioxol-5-yl)-3-(3-fluoro-4-imidazol-1-ylphenyl)urea;molecular hydrogen is O=C(Nc1ccc(-n2ccnc2)c(F)c1)Nc1ccc2c(c1)OCO2.[H][H].[H][H].
What is the InChIKey of 1-(1,3-benzodioxol-5-yl)-3-(3-fluoro-4-imidazol-1-ylphenyl)urea;molecular hydrogen?
The InChIKey is CHEKQLRJBGHPQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13FN4O3.2H2/c18-13-7-11(1-3-14(13)22-6-5-19-9-22)20-17(23)21-12-2-4-15-16(8-12)25-10-24-15;;/h1-9H,10H2,(H2,20,21,23);2*1H.
What are the key properties of 1-(1,3-benzodioxol-5-yl)-3-(3-fluoro-4-imidazol-1-ylphenyl)urea;molecular hydrogen?
1-(1,3-benzodioxol-5-yl)-3-(3-fluoro-4-imidazol-1-ylphenyl)urea;molecular hydrogen has a molecular weight of 344.35 g/mol, XLogP of 3.88, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-benzodioxol-5-yl)-3-(3-fluoro-4-imidazol-1-ylphenyl)urea;molecular hydrogen is sourced from PubChem (CID 143582920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).