C24H5FN14 — CID 143591815
27-fluoro-3,5,8,10,13,15,18,20,23,30-decazaheptacyclo[20.8.0.02,11.04,9.012,21.014,19.024,29]triaconta-1(30),2,4,6,8,10,12,14,16,18,20,22,24,26-tetradecaene-6,7,16,17-tetracarbonitrile (PubChem CID 143591815) has the molecular formula C24H5FN14 and a molecular weight of 508.40 g/mol. Its IUPAC name is 27-fluoro-3,5,8,10,13,15,18,20,23,30-decazaheptacyclo[20.8.0.02,11.04,9.012,21.014,19.024,29]triaconta-1(30),2,4,6,8,10,12,14,16,18,20,22,24,26-tetradecaene-6,7,16,17-tetracarbonitrile.
| Compound Name | 27-fluoro-3,5,8,10,13,15,18,20,23,30-decazaheptacyclo[20.8.0.02,11.04,9.012,21.014,19.024,29]triaconta-1(30),2,4,6,8,10,12,14,16,18,20,22,24,26-tetradecaene-6,7,16,17-tetracarbonitrile |
|---|---|
| PubChem CID | 143591815 |
| Molecular Formula | C24H5FN14 |
| Molecular Weight | 508.40 g/mol |
| Exact Mass | 508.08 |
| IUPAC Name | 27-fluoro-3,5,8,10,13,15,18,20,23,30-decazaheptacyclo[20.8.0.02,11.04,9.012,21.014,19.024,29]triaconta-1(30),2,4,6,8,10,12,14,16,18,20,22,24,26-tetradecaene-6,7,16,17-tetracarbonitrile |
| SMILES | N#Cc1nc2nc3c4c(c5nc6nc(C#N)c(C#N)nc6nc5c3nc2nc1C#N)=NC1CC(F)=CC=C1N=4 |
| InChI | InChI=1S/C24H5FN14/c25-8-1-2-9-10(3-8)31-16-15(30-9)17-19(38-23-21(36-17)32-11(4-26)13(6-28)34-23)20-18(16)37-22-24(39-20)35-14(7-29)12(5-27)33-22/h1-2,10H,3H2 |
| InChIKey | HULWDEOYHVDWDP-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 223.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.40 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|