2,3-dihydro-1H-indene;2-[(2-hydroxyacetyl)amino]acetic acid

C13H17NO4 — CID 143627034

IUPAC2,3-dihydro-1H-indene;2-[(2-hydroxyacetyl)amino]acetic acid
SMILESO=C(O)CNC(=O)CO.c1ccc2c(c1)CCC2
InChIInChI=1S/C9H10.C4H7NO4/c1-2-5-9-7-3-6-8(9)4-1;6-2-3(7)5-1-4(8)9/h1-2,4-5H,3,6-7H2;6H,1-2H2,(H,5,7)(H,8,9)
InChIKeyLCWFNPPADLEFKE-UHFFFAOYSA-N
MW251.28 g/mol
LogP0.35
Rot. Bonds3

About 2,3-dihydro-1H-indene;2-[(2-hydroxyacetyl)amino]acetic acid

2,3-dihydro-1H-indene;2-[(2-hydroxyacetyl)amino]acetic acid (PubChem CID 143627034) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is 2,3-dihydro-1H-indene;2-[(2-hydroxyacetyl)amino]acetic acid.

Molecular Properties

Compound Name2,3-dihydro-1H-indene;2-[(2-hydroxyacetyl)amino]acetic acid
PubChem CID143627034
Molecular FormulaC13H17NO4
Molecular Weight251.28 g/mol
Exact Mass251.12
IUPAC Name2,3-dihydro-1H-indene;2-[(2-hydroxyacetyl)amino]acetic acid
SMILESO=C(O)CNC(=O)CO.c1ccc2c(c1)CCC2
InChIInChI=1S/C9H10.C4H7NO4/c1-2-5-9-7-3-6-8(9)4-1;6-2-3(7)5-1-4(8)9/h1-2,4-5H,3,6-7H2;6H,1-2H2,(H,5,7)(H,8,9)
InChIKeyLCWFNPPADLEFKE-UHFFFAOYSA-N
XLogP0.35
TPSA86.63 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.28
LogP ≤ 50.35
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2,3-dihydro-1H-indene;2-[(2-hydroxyacetyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dihydro-1H-indene;2-[(2-hydroxyacetyl)amino]acetic acid?
The IUPAC name of 2,3-dihydro-1H-indene;2-[(2-hydroxyacetyl)amino]acetic acid (CID 143627034) is 2,3-dihydro-1H-indene;2-[(2-hydroxyacetyl)amino]acetic acid.
What is the SMILES notation for 2,3-dihydro-1H-indene;2-[(2-hydroxyacetyl)amino]acetic acid?
The canonical SMILES for 2,3-dihydro-1H-indene;2-[(2-hydroxyacetyl)amino]acetic acid is O=C(O)CNC(=O)CO.c1ccc2c(c1)CCC2.
What is the InChIKey of 2,3-dihydro-1H-indene;2-[(2-hydroxyacetyl)amino]acetic acid?
The InChIKey is LCWFNPPADLEFKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10.C4H7NO4/c1-2-5-9-7-3-6-8(9)4-1;6-2-3(7)5-1-4(8)9/h1-2,4-5H,3,6-7H2;6H,1-2H2,(H,5,7)(H,8,9).
What are the key properties of 2,3-dihydro-1H-indene;2-[(2-hydroxyacetyl)amino]acetic acid?
2,3-dihydro-1H-indene;2-[(2-hydroxyacetyl)amino]acetic acid has a molecular weight of 251.28 g/mol, XLogP of 0.35, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-indene;2-[(2-hydroxyacetyl)amino]acetic acid is sourced from PubChem (CID 143627034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).