C29H44N4OS — CID 143629508
3-[4-[[(4,4-dimethylcyclohexyl)amino]methyl]phenyl]-N'-[(E)-2-(trimethyl-λ4-sulfanyl)ethoxymethyliminomethyl]benzenecarboximidamide (PubChem CID 143629508) has the molecular formula C29H44N4OS and a molecular weight of 496.77 g/mol. Its IUPAC name is 3-[4-[[(4,4-dimethylcyclohexyl)amino]methyl]phenyl]-N'-[(E)-2-(trimethyl-λ4-sulfanyl)ethoxymethyliminomethyl]benzenecarboximidamide.
| Compound Name | 3-[4-[[(4,4-dimethylcyclohexyl)amino]methyl]phenyl]-N'-[(E)-2-(trimethyl-λ4-sulfanyl)ethoxymethyliminomethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 143629508 |
| Molecular Formula | C29H44N4OS |
| Molecular Weight | 496.77 g/mol |
| Exact Mass | 496.32 |
| IUPAC Name | 3-[4-[[(4,4-dimethylcyclohexyl)amino]methyl]phenyl]-N'-[(E)-2-(trimethyl-λ4-sulfanyl)ethoxymethyliminomethyl]benzenecarboximidamide |
| SMILES | CC1(C)CCC(NCc2ccc(-c3cccc(/C(N)=N/C=N/COCCS(C)(C)C)c3)cc2)CC1 |
| InChI | InChI=1S/C29H44N4OS/c1-29(2)15-13-27(14-16-29)32-20-23-9-11-24(12-10-23)25-7-6-8-26(19-25)28(30)33-21-31-22-34-17-18-35(3,4)5/h6-12,19,21,27,32H,13-18,20,22H2,1-5H3,(H2,30,31,33) |
| InChIKey | NMKKZLCWKUBPNY-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.77 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|