C30H42N4O2 — CID 143629519
[(E)-[[amino-[4-[3-[(2-cyclohexylethylamino)methyl]phenyl]-3-methylphenyl]methylidene]amino]methylideneamino]methyl 2,2-dimethylpropanoate (PubChem CID 143629519) has the molecular formula C30H42N4O2 and a molecular weight of 490.69 g/mol. Its IUPAC name is [(E)-[[amino-[4-[3-[(2-cyclohexylethylamino)methyl]phenyl]-3-methylphenyl]methylidene]amino]methylideneamino]methyl 2,2-dimethylpropanoate.
| Compound Name | [(E)-[[amino-[4-[3-[(2-cyclohexylethylamino)methyl]phenyl]-3-methylphenyl]methylidene]amino]methylideneamino]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 143629519 |
| Molecular Formula | C30H42N4O2 |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | [(E)-[[amino-[4-[3-[(2-cyclohexylethylamino)methyl]phenyl]-3-methylphenyl]methylidene]amino]methylideneamino]methyl 2,2-dimethylpropanoate |
| SMILES | Cc1cc(/C(N)=N/C=N/COC(=O)C(C)(C)C)ccc1-c1cccc(CNCCC2CCCCC2)c1 |
| InChI | InChI=1S/C30H42N4O2/c1-22-17-26(28(31)34-20-33-21-36-29(35)30(2,3)4)13-14-27(22)25-12-8-11-24(18-25)19-32-16-15-23-9-6-5-7-10-23/h8,11-14,17-18,20,23,32H,5-7,9-10,15-16,19,21H2,1-4H3,(H2,31,33,34) |
| InChIKey | OUDARAGUEJDDQP-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|