C9H10FNO2 — CID 143631181
5-fluoro-N-methyl-4H-1,3-benzodioxin-7-amine (PubChem CID 143631181) has the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. Its IUPAC name is 5-fluoro-N-methyl-4H-1,3-benzodioxin-7-amine.
| Compound Name | 5-fluoro-N-methyl-4H-1,3-benzodioxin-7-amine |
|---|---|
| PubChem CID | 143631181 |
| Molecular Formula | C9H10FNO2 |
| Molecular Weight | 183.18 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | 5-fluoro-N-methyl-4H-1,3-benzodioxin-7-amine |
| SMILES | CNc1cc(F)c2c(c1)OCOC2 |
| InChI | InChI=1S/C9H10FNO2/c1-11-6-2-8(10)7-4-12-5-13-9(7)3-6/h2-3,11H,4-5H2,1H3 |
| InChIKey | RWRSKLUYHCDWBP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.18 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |