C20H25N5O7 — CID 143634588
tert-butyl N-[1-[(2,4-dinitroanilino)oxyamino]-3-phenylpropan-2-yl]carbamate (PubChem CID 143634588) has the molecular formula C20H25N5O7 and a molecular weight of 447.45 g/mol. Its IUPAC name is tert-butyl N-[1-[(2,4-dinitroanilino)oxyamino]-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(2,4-dinitroanilino)oxyamino]-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 143634588 |
| Molecular Formula | C20H25N5O7 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | tert-butyl N-[1-[(2,4-dinitroanilino)oxyamino]-3-phenylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CNONc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])Cc1ccccc1 |
| InChI | InChI=1S/C20H25N5O7/c1-20(2,3)31-19(26)22-15(11-14-7-5-4-6-8-14)13-21-32-23-17-10-9-16(24(27)28)12-18(17)25(29)30/h4-10,12,15,21,23H,11,13H2,1-3H3,(H,22,26) |
| InChIKey | LHIBDLVHJIBUSD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 157.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|