C11H10O2 — CID 143638866
9H-benzo[7]annulene-5,7-diol (PubChem CID 143638866) has the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. Its IUPAC name is 9H-benzo[7]annulene-5,7-diol.
| Compound Name | 9H-benzo[7]annulene-5,7-diol |
|---|---|
| PubChem CID | 143638866 |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 9H-benzo[7]annulene-5,7-diol |
| SMILES | OC1=CCc2ccccc2C(O)=C1 |
| InChI | InChI=1S/C11H10O2/c12-9-6-5-8-3-1-2-4-10(8)11(13)7-9/h1-4,6-7,12-13H,5H2 |
| InChIKey | WTVMFYDCCDYFNZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |