3H-indene-1-sulfinic acid

C9H8O2S — CID 67326811

IUPAC3H-indene-1-sulfinic acid
SMILESO=S(O)C1=CCc2ccccc21
InChIInChI=1S/C9H8O2S/c10-12(11)9-6-5-7-3-1-2-4-8(7)9/h1-4,6H,5H2,(H,10,11)
InChIKeyXACYWHHQFWIYKO-UHFFFAOYSA-N
MW180.23 g/mol
LogP1.81
Rot. Bonds1

About 3H-indene-1-sulfinic acid

3H-indene-1-sulfinic acid (PubChem CID 67326811) has the molecular formula C9H8O2S and a molecular weight of 180.23 g/mol. Its IUPAC name is 3H-indene-1-sulfinic acid.

Molecular Properties

Compound Name3H-indene-1-sulfinic acid
PubChem CID67326811
Molecular FormulaC9H8O2S
Molecular Weight180.23 g/mol
Exact Mass180.02
IUPAC Name3H-indene-1-sulfinic acid
SMILESO=S(O)C1=CCc2ccccc21
InChIInChI=1S/C9H8O2S/c10-12(11)9-6-5-7-3-1-2-4-8(7)9/h1-4,6H,5H2,(H,10,11)
InChIKeyXACYWHHQFWIYKO-UHFFFAOYSA-N
XLogP1.81
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.23
LogP ≤ 51.81
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze 3H-indene-1-sulfinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3H-indene-1-sulfinic acid?
The IUPAC name of 3H-indene-1-sulfinic acid (CID 67326811) is 3H-indene-1-sulfinic acid.
What is the SMILES notation for 3H-indene-1-sulfinic acid?
The canonical SMILES for 3H-indene-1-sulfinic acid is O=S(O)C1=CCc2ccccc21.
What is the InChIKey of 3H-indene-1-sulfinic acid?
The InChIKey is XACYWHHQFWIYKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O2S/c10-12(11)9-6-5-7-3-1-2-4-8(7)9/h1-4,6H,5H2,(H,10,11).
What are the key properties of 3H-indene-1-sulfinic acid?
3H-indene-1-sulfinic acid has a molecular weight of 180.23 g/mol, XLogP of 1.81, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-indene-1-sulfinic acid is sourced from PubChem (CID 67326811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).