C18H22N2O4S — CID 143643331
(5S,8Z)-2,2-dioxo-2λ6-thia-3,15-diazatricyclo[15.3.1.05,7]henicosa-1(20),8,17(21),18-tetraene-4,16-dione (PubChem CID 143643331) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is (5S,8Z)-2,2-dioxo-2λ6-thia-3,15-diazatricyclo[15.3.1.05,7]henicosa-1(20),8,17(21),18-tetraene-4,16-dione.
| Compound Name | (5S,8Z)-2,2-dioxo-2λ6-thia-3,15-diazatricyclo[15.3.1.05,7]henicosa-1(20),8,17(21),18-tetraene-4,16-dione |
|---|---|
| PubChem CID | 143643331 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | (5S,8Z)-2,2-dioxo-2λ6-thia-3,15-diazatricyclo[15.3.1.05,7]henicosa-1(20),8,17(21),18-tetraene-4,16-dione |
| SMILES | O=C1NCCCCC/C=C\C2C[C@@H]2C(=O)NS(=O)(=O)c2cccc1c2 |
| InChI | InChI=1S/C18H22N2O4S/c21-17-14-8-6-9-15(11-14)25(23,24)20-18(22)16-12-13(16)7-4-2-1-3-5-10-19-17/h4,6-9,11,13,16H,1-3,5,10,12H2,(H,19,21)(H,20,22)/b7-4-/t13?,16-/m0/s1 |
| InChIKey | WPBNAHJCQVEHTD-AGTZPTDPSA-N |
| XLogP | 1.99 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|