C22H33N3O5S — CID 143643401
tert-butyl carbamate;(5S,7S,8Z)-2,2-dioxo-2λ6-thia-3,15-diazatricyclo[14.4.0.05,7]icosa-1(20),8,16,18-tetraen-4-one (PubChem CID 143643401) has the molecular formula C22H33N3O5S and a molecular weight of 451.59 g/mol. Its IUPAC name is tert-butyl carbamate;(5S,7S,8Z)-2,2-dioxo-2λ6-thia-3,15-diazatricyclo[14.4.0.05,7]icosa-1(20),8,16,18-tetraen-4-one.
| Compound Name | tert-butyl carbamate;(5S,7S,8Z)-2,2-dioxo-2λ6-thia-3,15-diazatricyclo[14.4.0.05,7]icosa-1(20),8,16,18-tetraen-4-one |
|---|---|
| PubChem CID | 143643401 |
| Molecular Formula | C22H33N3O5S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | tert-butyl carbamate;(5S,7S,8Z)-2,2-dioxo-2λ6-thia-3,15-diazatricyclo[14.4.0.05,7]icosa-1(20),8,16,18-tetraen-4-one |
| SMILES | CC(C)(C)OC(N)=O.O=C1NS(=O)(=O)c2ccccc2NCCCCC/C=C\[C@@H]2C[C@H]12 |
| InChI | InChI=1S/C17H22N2O3S.C5H11NO2/c20-17-14-12-13(14)8-4-2-1-3-7-11-18-15-9-5-6-10-16(15)23(21,22)19-17;1-5(2,3)8-4(6)7/h4-6,8-10,13-14,18H,1-3,7,11-12H2,(H,19,20);1-3H3,(H2,6,7)/b8-4-;/t13-,14+;/m1./s1 |
| InChIKey | SZTZQSYLFFIAMU-QEOKPTAMSA-N |
| XLogP | 3.55 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|