C28H49N3 — CID 143659652
ethane;ethene;(Z)-N-[(E)-4-[(6-ethylcyclohexa-1,5-dien-1-yl)amino]but-1-enyl]-3-methyl-2-propan-2-yl-N'-[(E)-prop-1-enyl]pent-3-enimidamide (PubChem CID 143659652) has the molecular formula C28H49N3 and a molecular weight of 427.72 g/mol. Its IUPAC name is ethane;ethene;(Z)-N-[(E)-4-[(6-ethylcyclohexa-1,5-dien-1-yl)amino]but-1-enyl]-3-methyl-2-propan-2-yl-N'-[(E)-prop-1-enyl]pent-3-enimidamide.
| Compound Name | ethane;ethene;(Z)-N-[(E)-4-[(6-ethylcyclohexa-1,5-dien-1-yl)amino]but-1-enyl]-3-methyl-2-propan-2-yl-N'-[(E)-prop-1-enyl]pent-3-enimidamide |
|---|---|
| PubChem CID | 143659652 |
| Molecular Formula | C28H49N3 |
| Molecular Weight | 427.72 g/mol |
| Exact Mass | 427.39 |
| IUPAC Name | ethane;ethene;(Z)-N-[(E)-4-[(6-ethylcyclohexa-1,5-dien-1-yl)amino]but-1-enyl]-3-methyl-2-propan-2-yl-N'-[(E)-prop-1-enyl]pent-3-enimidamide |
| SMILES | C/C=C(/C)C(/C(=N/C=C/C)N/C=C/CCNC1=CCCC=C1CC)C(C)C.C=C.CC |
| InChI | InChI=1S/C24H39N3.C2H6.C2H4/c1-7-16-26-24(23(19(4)5)20(6)8-2)27-18-13-12-17-25-22-15-11-10-14-21(22)9-3;2*1-2/h7-8,13-16,18-19,23,25H,9-12,17H2,1-6H3,(H,26,27);1-2H3;1-2H2/b16-7+,18-13+,20-8-;; |
| InChIKey | CMDJOSWDUVNFAI-IILIKHRUSA-N |
| XLogP | 8.08 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.72 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|