C9H10NO3S+ — CID 143665841
(3a-methyl-1,3-dioxo-7,7a-dihydro-4H-2-benzofuran-5-yl)-iminosulfanium (PubChem CID 143665841) has the molecular formula C9H10NO3S+ and a molecular weight of 212.25 g/mol. Its IUPAC name is (3a-methyl-1,3-dioxo-7,7a-dihydro-4H-2-benzofuran-5-yl)-iminosulfanium.
| Compound Name | (3a-methyl-1,3-dioxo-7,7a-dihydro-4H-2-benzofuran-5-yl)-iminosulfanium |
|---|---|
| PubChem CID | 143665841 |
| Molecular Formula | C9H10NO3S+ |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | (3a-methyl-1,3-dioxo-7,7a-dihydro-4H-2-benzofuran-5-yl)-iminosulfanium |
| SMILES | [H]/N=[S+]/C1=CCC2C(=O)OC(=O)C2(C)C1 |
| InChI | InChI=1S/C9H10NO3S/c1-9-4-5(14-10)2-3-6(9)7(11)13-8(9)12/h2,6,10H,3-4H2,1H3/q+1 |
| InChIKey | VBCNYZFCLFZRIY-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 67.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|