C21H32O3 — CID 144537436
7a-methyl-5-[(E)-2,6,7,7-tetramethyloct-5-en-2-yl]-4,7-dihydro-3aH-2-benzofuran-1,3-dione (PubChem CID 144537436) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is 7a-methyl-5-[(E)-2,6,7,7-tetramethyloct-5-en-2-yl]-4,7-dihydro-3aH-2-benzofuran-1,3-dione.
| Compound Name | 7a-methyl-5-[(E)-2,6,7,7-tetramethyloct-5-en-2-yl]-4,7-dihydro-3aH-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 144537436 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | 7a-methyl-5-[(E)-2,6,7,7-tetramethyloct-5-en-2-yl]-4,7-dihydro-3aH-2-benzofuran-1,3-dione |
| SMILES | C/C(=C\CCC(C)(C)C1=CCC2(C)C(=O)OC(=O)C2C1)C(C)(C)C |
| InChI | InChI=1S/C21H32O3/c1-14(19(2,3)4)9-8-11-20(5,6)15-10-12-21(7)16(13-15)17(22)24-18(21)23/h9-10,16H,8,11-13H2,1-7H3/b14-9+ |
| InChIKey | GUAIZCBJWLAURA-NTEUORMPSA-N |
| XLogP | 5.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|