C25H42O4 — CID 144537440
dipropan-2-yl 4-[(E)-2,6,7-trimethyloct-5-en-2-yl]cyclohex-4-ene-1,2-dicarboxylate (PubChem CID 144537440) has the molecular formula C25H42O4 and a molecular weight of 406.61 g/mol. Its IUPAC name is dipropan-2-yl 4-[(E)-2,6,7-trimethyloct-5-en-2-yl]cyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | dipropan-2-yl 4-[(E)-2,6,7-trimethyloct-5-en-2-yl]cyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 144537440 |
| Molecular Formula | C25H42O4 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.31 |
| IUPAC Name | dipropan-2-yl 4-[(E)-2,6,7-trimethyloct-5-en-2-yl]cyclohex-4-ene-1,2-dicarboxylate |
| SMILES | C/C(=C\CCC(C)(C)C1=CCC(C(=O)OC(C)C)C(C(=O)OC(C)C)C1)C(C)C |
| InChI | InChI=1S/C25H42O4/c1-16(2)19(7)11-10-14-25(8,9)20-12-13-21(23(26)28-17(3)4)22(15-20)24(27)29-18(5)6/h11-12,16-18,21-22H,10,13-15H2,1-9H3/b19-11+ |
| InChIKey | OCLFRDVDUAQSHR-YBFXNURJSA-N |
| XLogP | 6.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|