C27H27FN2O3 — CID 143674290
methyl 6-[2-[(12S)-6-(4-fluorophenyl)-13-oxa-5,6-diazatetracyclo[7.4.0.01,12.03,7]trideca-3(7),4,8-trien-12-yl]ethyl]-6-methylcyclohexa-2,4-diene-1-carboxylate (PubChem CID 143674290) has the molecular formula C27H27FN2O3 and a molecular weight of 446.52 g/mol. Its IUPAC name is methyl 6-[2-[(12S)-6-(4-fluorophenyl)-13-oxa-5,6-diazatetracyclo[7.4.0.01,12.03,7]trideca-3(7),4,8-trien-12-yl]ethyl]-6-methylcyclohexa-2,4-diene-1-carboxylate.
| Compound Name | methyl 6-[2-[(12S)-6-(4-fluorophenyl)-13-oxa-5,6-diazatetracyclo[7.4.0.01,12.03,7]trideca-3(7),4,8-trien-12-yl]ethyl]-6-methylcyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 143674290 |
| Molecular Formula | C27H27FN2O3 |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | methyl 6-[2-[(12S)-6-(4-fluorophenyl)-13-oxa-5,6-diazatetracyclo[7.4.0.01,12.03,7]trideca-3(7),4,8-trien-12-yl]ethyl]-6-methylcyclohexa-2,4-diene-1-carboxylate |
| SMILES | COC(=O)C1C=CC=CC1(C)CC[C@]12CCC3=Cc4c(cnn4-c4ccc(F)cc4)CC31O2 |
| InChI | InChI=1S/C27H27FN2O3/c1-25(11-4-3-5-22(25)24(31)32-2)13-14-26-12-10-19-15-23-18(16-27(19,26)33-26)17-29-30(23)21-8-6-20(28)7-9-21/h3-9,11,15,17,22H,10,12-14,16H2,1-2H3/t22?,25?,26-,27?/m1/s1 |
| InChIKey | SUGPESSKGIQUQQ-KCBUDPKISA-N |
| XLogP | 4.95 |
| TPSA | 56.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|