C28H30FN3O2 — CID 143674335
(2E,4Z)-2-ethenyl-N-ethyl-3-[2-[(12S)-6-(4-fluorophenyl)-13-oxa-5,6-diazatetracyclo[7.4.0.01,12.03,7]trideca-3(7),4,8-trien-12-yl]ethyl]hexa-2,4-dienamide (PubChem CID 143674335) has the molecular formula C28H30FN3O2 and a molecular weight of 459.57 g/mol. Its IUPAC name is (2E,4Z)-2-ethenyl-N-ethyl-3-[2-[(12S)-6-(4-fluorophenyl)-13-oxa-5,6-diazatetracyclo[7.4.0.01,12.03,7]trideca-3(7),4,8-trien-12-yl]ethyl]hexa-2,4-dienamide.
| Compound Name | (2E,4Z)-2-ethenyl-N-ethyl-3-[2-[(12S)-6-(4-fluorophenyl)-13-oxa-5,6-diazatetracyclo[7.4.0.01,12.03,7]trideca-3(7),4,8-trien-12-yl]ethyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 143674335 |
| Molecular Formula | C28H30FN3O2 |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | (2E,4Z)-2-ethenyl-N-ethyl-3-[2-[(12S)-6-(4-fluorophenyl)-13-oxa-5,6-diazatetracyclo[7.4.0.01,12.03,7]trideca-3(7),4,8-trien-12-yl]ethyl]hexa-2,4-dienamide |
| SMILES | C=C/C(C(=O)NCC)=C(\C=C/C)CC[C@]12CCC3=Cc4c(cnn4-c4ccc(F)cc4)CC31O2 |
| InChI | InChI=1S/C28H30FN3O2/c1-4-7-19(24(5-2)26(33)30-6-3)12-14-27-15-13-21-16-25-20(17-28(21,27)34-27)18-31-32(25)23-10-8-22(29)9-11-23/h4-5,7-11,16,18H,2,6,12-15,17H2,1,3H3,(H,30,33)/b7-4-,24-19-/t27-,28?/m0/s1 |
| InChIKey | DLDXPPNESGUQOS-YXSXUDQUSA-N |
| XLogP | 5.23 |
| TPSA | 59.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|