About 12-methyl-5-oxatricyclo[7.3.1.02,6]trideca-1,6,8-triene
12-methyl-5-oxatricyclo[7.3.1.02,6]trideca-1,6,8-triene (PubChem CID 143676827) has the molecular formula C13H16O
and a molecular weight of 188.27 g/mol. Its IUPAC name is 12-methyl-5-oxatricyclo[7.3.1.02,6]trideca-1,6,8-triene.
Analyze 12-methyl-5-oxatricyclo[7.3.1.02,6]trideca-1,6,8-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-methyl-5-oxatricyclo[7.3.1.02,6]trideca-1,6,8-triene?
The IUPAC name of 12-methyl-5-oxatricyclo[7.3.1.02,6]trideca-1,6,8-triene (CID 143676827) is 12-methyl-5-oxatricyclo[7.3.1.02,6]trideca-1,6,8-triene.
What is the SMILES notation for 12-methyl-5-oxatricyclo[7.3.1.02,6]trideca-1,6,8-triene?
The canonical SMILES for 12-methyl-5-oxatricyclo[7.3.1.02,6]trideca-1,6,8-triene is CC1CCC2=CC=C3OCCC3=C1C2.
What is the InChIKey of 12-methyl-5-oxatricyclo[7.3.1.02,6]trideca-1,6,8-triene?
The InChIKey is KPMBISQMCNTFCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O/c1-9-2-3-10-4-5-13-11(6-7-14-13)12(9)8-10/h4-5,9H,2-3,6-8H2,1H3.
What are the key properties of 12-methyl-5-oxatricyclo[7.3.1.02,6]trideca-1,6,8-triene?
12-methyl-5-oxatricyclo[7.3.1.02,6]trideca-1,6,8-triene has a molecular weight of 188.27 g/mol, XLogP of 3.35, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 12-methyl-5-oxatricyclo[7.3.1.02,6]trideca-1,6,8-triene is sourced from PubChem (CID 143676827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).