C23H33IO2S — CID 143680957
3-(10b,12a-dimethyl-3,4a,4b,5,6,7,8,9,11,12-decahydro-2H-phenanthro[1,2-b][1,4]dioxin-6a-yl)prop-1-ynyl thiohypoiodite;ethene (PubChem CID 143680957) has the molecular formula C23H33IO2S and a molecular weight of 500.49 g/mol. Its IUPAC name is 3-(10b,12a-dimethyl-3,4a,4b,5,6,7,8,9,11,12-decahydro-2H-phenanthro[1,2-b][1,4]dioxin-6a-yl)prop-1-ynyl thiohypoiodite;ethene.
| Compound Name | 3-(10b,12a-dimethyl-3,4a,4b,5,6,7,8,9,11,12-decahydro-2H-phenanthro[1,2-b][1,4]dioxin-6a-yl)prop-1-ynyl thiohypoiodite;ethene |
|---|---|
| PubChem CID | 143680957 |
| Molecular Formula | C23H33IO2S |
| Molecular Weight | 500.49 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | 3-(10b,12a-dimethyl-3,4a,4b,5,6,7,8,9,11,12-decahydro-2H-phenanthro[1,2-b][1,4]dioxin-6a-yl)prop-1-ynyl thiohypoiodite;ethene |
| SMILES | C=C.CC12CCC3(C)C4=CCCCC4(CC#CSI)CCC3C1OCCO2 |
| InChI | InChI=1S/C21H29IO2S.C2H4/c1-19-11-12-20(2)18(23-13-14-24-20)16(19)7-10-21(9-5-15-25-22)8-4-3-6-17(19)21;1-2/h6,16,18H,3-4,7-14H2,1-2H3;1-2H2 |
| InChIKey | IXVGSABVGGEMQD-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.49 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|