C19H33NO — CID 143693789
(3Z)-3-(2,2-dimethylpropylidene)-2-methylidene-5-(piperidin-4-ylmethyl)cyclopentan-1-one;ethane (PubChem CID 143693789) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is (3Z)-3-(2,2-dimethylpropylidene)-2-methylidene-5-(piperidin-4-ylmethyl)cyclopentan-1-one;ethane.
| Compound Name | (3Z)-3-(2,2-dimethylpropylidene)-2-methylidene-5-(piperidin-4-ylmethyl)cyclopentan-1-one;ethane |
|---|---|
| PubChem CID | 143693789 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | (3Z)-3-(2,2-dimethylpropylidene)-2-methylidene-5-(piperidin-4-ylmethyl)cyclopentan-1-one;ethane |
| SMILES | C=C1C(=O)C(CC2CCNCC2)C/C1=C/C(C)(C)C.CC |
| InChI | InChI=1S/C17H27NO.C2H6/c1-12-15(11-17(2,3)4)10-14(16(12)19)9-13-5-7-18-8-6-13;1-2/h11,13-14,18H,1,5-10H2,2-4H3;1-2H3/b15-11-; |
| InChIKey | DEYPYYVYOLFIFY-PNCOJPCNSA-N |
| XLogP | 4.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|