C30H35N3O6 — CID 143707919
[(Z)-[[2,4-di(propan-2-yloxy)phenyl]-[(2E)-1-ethyl-3-methylidene-2-[(E)-3-nitrobut-2-enylidene]indol-5-yl]methylidene]amino] acetate (PubChem CID 143707919) has the molecular formula C30H35N3O6 and a molecular weight of 533.63 g/mol. Its IUPAC name is [(Z)-[[2,4-di(propan-2-yloxy)phenyl]-[(2E)-1-ethyl-3-methylidene-2-[(E)-3-nitrobut-2-enylidene]indol-5-yl]methylidene]amino] acetate.
| Compound Name | [(Z)-[[2,4-di(propan-2-yloxy)phenyl]-[(2E)-1-ethyl-3-methylidene-2-[(E)-3-nitrobut-2-enylidene]indol-5-yl]methylidene]amino] acetate |
|---|---|
| PubChem CID | 143707919 |
| Molecular Formula | C30H35N3O6 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.25 |
| IUPAC Name | [(Z)-[[2,4-di(propan-2-yloxy)phenyl]-[(2E)-1-ethyl-3-methylidene-2-[(E)-3-nitrobut-2-enylidene]indol-5-yl]methylidene]amino] acetate |
| SMILES | C=c1/c(=C\C=C(/C)[N+](=O)[O-])n(CC)c2ccc(/C(=N/OC(C)=O)c3ccc(OC(C)C)cc3OC(C)C)cc12 |
| InChI | InChI=1S/C30H35N3O6/c1-9-32-27(14-10-20(6)33(35)36)21(7)26-16-23(11-15-28(26)32)30(31-39-22(8)34)25-13-12-24(37-18(2)3)17-29(25)38-19(4)5/h10-19H,7,9H2,1-6,8H3/b20-10+,27-14+,31-30- |
| InChIKey | PXEGDPULCQSDBV-QESAUREISA-N |
| XLogP | 4.92 |
| TPSA | 105.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|