C11H21NO — CID 143711002
(3E,5E)-5-(propylamino)octa-3,5-dien-4-ol (PubChem CID 143711002) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is (3E,5E)-5-(propylamino)octa-3,5-dien-4-ol.
| Compound Name | (3E,5E)-5-(propylamino)octa-3,5-dien-4-ol |
|---|---|
| PubChem CID | 143711002 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (3E,5E)-5-(propylamino)octa-3,5-dien-4-ol |
| SMILES | CC/C=C(O)\C(=C/CC)NCCC |
| InChI | InChI=1S/C11H21NO/c1-4-7-10(12-9-6-3)11(13)8-5-2/h7-8,12-13H,4-6,9H2,1-3H3/b10-7+,11-8+ |
| InChIKey | UFCOMLLJVIOSOZ-AMMQDNIMSA-N |
| XLogP | 3.13 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|