C27H45Cl — CID 143719464
(3aS,4E)-1-(1-chloropropan-2-yl)-4-[2-[(3R)-4-ethylidene-3,5-dimethylcyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-indene;ethane (PubChem CID 143719464) has the molecular formula C27H45Cl and a molecular weight of 405.11 g/mol. Its IUPAC name is (3aS,4E)-1-(1-chloropropan-2-yl)-4-[2-[(3R)-4-ethylidene-3,5-dimethylcyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-indene;ethane.
| Compound Name | (3aS,4E)-1-(1-chloropropan-2-yl)-4-[2-[(3R)-4-ethylidene-3,5-dimethylcyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-indene;ethane |
|---|---|
| PubChem CID | 143719464 |
| Molecular Formula | C27H45Cl |
| Molecular Weight | 405.11 g/mol |
| Exact Mass | 404.32 |
| IUPAC Name | (3aS,4E)-1-(1-chloropropan-2-yl)-4-[2-[(3R)-4-ethylidene-3,5-dimethylcyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-indene;ethane |
| SMILES | C/C=C1\C(C)C/C(=C/C=C2\CCCC3(C)C(C(C)CCl)CC[C@@H]23)C[C@H]1C.CC |
| InChI | InChI=1S/C25H39Cl.C2H6/c1-6-22-17(2)14-20(15-18(22)3)9-10-21-8-7-13-25(5)23(19(4)16-26)11-12-24(21)25;1-2/h6,9-10,17-19,23-24H,7-8,11-16H2,1-5H3;1-2H3/b20-9-,21-10+,22-6+;/t17?,18-,19?,23?,24+,25?;/m1./s1 |
| InChIKey | PIYNIBXQWFRXDA-BIAAEWOJSA-N |
| XLogP | 8.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.11 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|