C7H12O5S — CID 143721594
(2S,4S)-4-hydroxy-6-methylsulfanyloxyoxane-2-carboxylic acid (PubChem CID 143721594) has the molecular formula C7H12O5S and a molecular weight of 208.23 g/mol. Its IUPAC name is (2S,4S)-4-hydroxy-6-methylsulfanyloxyoxane-2-carboxylic acid.
| Compound Name | (2S,4S)-4-hydroxy-6-methylsulfanyloxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 143721594 |
| Molecular Formula | C7H12O5S |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | (2S,4S)-4-hydroxy-6-methylsulfanyloxyoxane-2-carboxylic acid |
| SMILES | CSOC1C[C@@H](O)C[C@@H](C(=O)O)O1 |
| InChI | InChI=1S/C7H12O5S/c1-13-12-6-3-4(8)2-5(11-6)7(9)10/h4-6,8H,2-3H2,1H3,(H,9,10)/t4-,5-,6?/m0/s1 |
| InChIKey | FCALJBPMKVMFQF-HVYQYDHPSA-N |
| XLogP | 0.23 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|