C16H31NO8 — CID 178003190
6-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]-4-hydroxyoxane-2-carboxylic acid;ethane (PubChem CID 178003190) has the molecular formula C16H31NO8 and a molecular weight of 365.42 g/mol. Its IUPAC name is 6-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]-4-hydroxyoxane-2-carboxylic acid;ethane.
| Compound Name | 6-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]-4-hydroxyoxane-2-carboxylic acid;ethane |
|---|---|
| PubChem CID | 178003190 |
| Molecular Formula | C16H31NO8 |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 6-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]-4-hydroxyoxane-2-carboxylic acid;ethane |
| SMILES | CC.CC(=O)NCCOCCOCCOC1CC(O)CC(C(=O)O)O1 |
| InChI | InChI=1S/C14H25NO8.C2H6/c1-10(16)15-2-3-20-4-5-21-6-7-22-13-9-11(17)8-12(23-13)14(18)19;1-2/h11-13,17H,2-9H2,1H3,(H,15,16)(H,18,19);1-2H3 |
| InChIKey | LKLGKEKIUVAWNR-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|