C26H34F2N2 — CID 143722054
N-[3-[(1E,3E,5Z)-3-fluoro-1-(4-fluorophenyl)-2-methylhepta-1,3,5-trienyl]iminopent-1-en-2-yl]-1-methylcyclohexan-1-amine (PubChem CID 143722054) has the molecular formula C26H34F2N2 and a molecular weight of 412.57 g/mol. Its IUPAC name is N-[3-[(1E,3E,5Z)-3-fluoro-1-(4-fluorophenyl)-2-methylhepta-1,3,5-trienyl]iminopent-1-en-2-yl]-1-methylcyclohexan-1-amine.
| Compound Name | N-[3-[(1E,3E,5Z)-3-fluoro-1-(4-fluorophenyl)-2-methylhepta-1,3,5-trienyl]iminopent-1-en-2-yl]-1-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 143722054 |
| Molecular Formula | C26H34F2N2 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | N-[3-[(1E,3E,5Z)-3-fluoro-1-(4-fluorophenyl)-2-methylhepta-1,3,5-trienyl]iminopent-1-en-2-yl]-1-methylcyclohexan-1-amine |
| SMILES | C=C(NC1(C)CCCCC1)/C(CC)=N/C(=C(C)/C(F)=C\C=C/C)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H34F2N2/c1-6-8-12-23(28)19(3)25(21-13-15-22(27)16-14-21)29-24(7-2)20(4)30-26(5)17-10-9-11-18-26/h6,8,12-16,30H,4,7,9-11,17-18H2,1-3,5H3/b8-6-,23-12+,25-19+,29-24+ |
| InChIKey | SOSLRUOLMLWUPN-VEZNGZKNSA-N |
| XLogP | 7.66 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|