C13H11ClFN3O2 — CID 143731872
[(4R)-5-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-4-ethynyloxolan-2-yl]methanol (PubChem CID 143731872) has the molecular formula C13H11ClFN3O2 and a molecular weight of 295.70 g/mol. Its IUPAC name is [(4R)-5-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-4-ethynyloxolan-2-yl]methanol.
| Compound Name | [(4R)-5-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-4-ethynyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 143731872 |
| Molecular Formula | C13H11ClFN3O2 |
| Molecular Weight | 295.70 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | [(4R)-5-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-4-ethynyloxolan-2-yl]methanol |
| SMILES | C#C[C@H]1CC(CO)OC1n1cc(F)c2c(Cl)ncnc21 |
| InChI | InChI=1S/C13H11ClFN3O2/c1-2-7-3-8(5-19)20-13(7)18-4-9(15)10-11(14)16-6-17-12(10)18/h1,4,6-8,13,19H,3,5H2/t7-,8?,13?/m0/s1 |
| InChIKey | UHKNTTZOOVTWLJ-DWHFKYGWSA-N |
| XLogP | 1.75 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.70 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|