C12H15N5O2 — CID 143717497
[5-(2-amino-3,6-dihydropurin-9-yl)-4-ethynyloxolan-2-yl]methanol (PubChem CID 143717497) has the molecular formula C12H15N5O2 and a molecular weight of 261.28 g/mol. Its IUPAC name is [5-(2-amino-3,6-dihydropurin-9-yl)-4-ethynyloxolan-2-yl]methanol.
| Compound Name | [5-(2-amino-3,6-dihydropurin-9-yl)-4-ethynyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 143717497 |
| Molecular Formula | C12H15N5O2 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | [5-(2-amino-3,6-dihydropurin-9-yl)-4-ethynyloxolan-2-yl]methanol |
| SMILES | C#CC1CC(CO)OC1n1cnc2c1NC(N)=NC2 |
| InChI | InChI=1S/C12H15N5O2/c1-2-7-3-8(5-18)19-11(7)17-6-15-9-4-14-12(13)16-10(9)17/h1,6-8,11,18H,3-5H2,(H3,13,14,16) |
| InChIKey | PILHKGSYGISQQA-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|